About [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate
[4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate (PubChem CID 12912162) has the molecular formula C19H12Cl2N4O7
and a molecular weight of 479.23 g/mol. Its IUPAC name is [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate.
Molecular Properties
| Compound Name | [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate |
| PubChem CID | 12912162 |
| Molecular Formula | C19H12Cl2N4O7 |
| Molecular Weight | 479.23 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate |
| SMILES | Cc1nn(C)c(OC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H12Cl2N4O7/c1-9-16(17(26)12-5-3-10(24(28)29)7-14(12)20)18(23(2)22-9)32-19(27)13-6-4-11(25(30)31)8-15(13)21/h3-8H,1-2H3 |
| InChIKey | LXOJRSUKRJDOQX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 147.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate?
The IUPAC name of [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate (CID 12912162) is [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate.
What is the SMILES notation for [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate?
The canonical SMILES for [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate is Cc1nn(C)c(OC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1C(=O)c1ccc([N+](=O)[O-])cc1Cl.
What is the InChIKey of [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate?
The InChIKey is LXOJRSUKRJDOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2N4O7/c1-9-16(17(26)12-5-3-10(24(28)29)7-14(12)20)18(23(2)22-9)32-19(27)13-6-4-11(25(30)31)8-15(13)21/h3-8H,1-2H3.
What are the key properties of [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate?
[4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate has a molecular weight of 479.23 g/mol, XLogP of 4.30, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chloro-4-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl] 2-chloro-4-nitrobenzoate is sourced from PubChem (CID 12912162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).