C13H12Cl2N2O4S — CID 12912181
[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] methanesulfonate (PubChem CID 12912181) has the molecular formula C13H12Cl2N2O4S and a molecular weight of 363.22 g/mol. Its IUPAC name is [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] methanesulfonate.
| Compound Name | [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 12912181 |
| Molecular Formula | C13H12Cl2N2O4S |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] methanesulfonate |
| SMILES | Cc1nn(C)c(OS(C)(=O)=O)c1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O4S/c1-7-11(13(17(2)16-7)21-22(3,19)20)12(18)9-5-4-8(14)6-10(9)15/h4-6H,1-3H3 |
| InChIKey | PGPSCFSXHNVZPZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|