About (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone
(2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone (PubChem CID 54418109) has the molecular formula C20H18Cl2N2O
and a molecular weight of 373.28 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone |
| PubChem CID | 54418109 |
| Molecular Formula | C20H18Cl2N2O |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone |
| SMILES | Cc1ccc(Cc2c(C(=O)c3ccc(Cl)cc3Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O/c1-12-4-6-14(7-5-12)10-18-19(13(2)23-24(18)3)20(25)16-9-8-15(21)11-17(16)22/h4-9,11H,10H2,1-3H3 |
| InChIKey | VYWJOGWISXNJFM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone?
The IUPAC name of (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone (CID 54418109) is (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone.
What is the SMILES notation for (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone?
The canonical SMILES for (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone is Cc1ccc(Cc2c(C(=O)c3ccc(Cl)cc3Cl)c(C)nn2C)cc1.
What is the InChIKey of (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone?
The InChIKey is VYWJOGWISXNJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2N2O/c1-12-4-6-14(7-5-12)10-18-19(13(2)23-24(18)3)20(25)16-9-8-15(21)11-17(16)22/h4-9,11H,10H2,1-3H3.
What are the key properties of (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone?
(2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone has a molecular weight of 373.28 g/mol, XLogP of 5.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)-[1,3-dimethyl-5-[(4-methylphenyl)methyl]pyrazol-4-yl]methanone is sourced from PubChem (CID 54418109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).