C15H14Cl2N2O3S — CID 12912178
[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] ethylsulfanylformate (PubChem CID 12912178) has the molecular formula C15H14Cl2N2O3S and a molecular weight of 373.26 g/mol. Its IUPAC name is [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] ethylsulfanylformate.
| Compound Name | [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] ethylsulfanylformate |
|---|---|
| PubChem CID | 12912178 |
| Molecular Formula | C15H14Cl2N2O3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | [4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] ethylsulfanylformate |
| SMILES | CCSC(=O)Oc1c(C(=O)c2ccc(Cl)cc2Cl)c(C)nn1C |
| InChI | InChI=1S/C15H14Cl2N2O3S/c1-4-23-15(21)22-14-12(8(2)18-19(14)3)13(20)10-6-5-9(16)7-11(10)17/h5-7H,4H2,1-3H3 |
| InChIKey | ZHMLFSNJNVJMND-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|