C25H18Cl4N4O5 — CID 13002616
bis[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] carbonate (PubChem CID 13002616) has the molecular formula C25H18Cl4N4O5 and a molecular weight of 596.25 g/mol. Its IUPAC name is bis[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] carbonate.
| Compound Name | bis[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] carbonate |
|---|---|
| PubChem CID | 13002616 |
| Molecular Formula | C25H18Cl4N4O5 |
| Molecular Weight | 596.25 g/mol |
| Exact Mass | 594.00 |
| IUPAC Name | bis[4-(2,4-dichlorobenzoyl)-1,3-dimethylpyrazol-5-yl] carbonate |
| SMILES | Cc1nn(C)c(OC(=O)Oc2c(C(=O)c3ccc(Cl)cc3Cl)c(C)nn2C)c1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H18Cl4N4O5/c1-11-19(21(34)15-7-5-13(26)9-17(15)28)23(32(3)30-11)37-25(36)38-24-20(12(2)31-33(24)4)22(35)16-8-6-14(27)10-18(16)29/h5-10H,1-4H3 |
| InChIKey | BZYXVNXTFREIQN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.25 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |