C21H21Cl2N3O2 — CID 13277512
[5-(3-anilinopropoxy)-1,3-dimethylpyrazol-4-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 13277512) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is [5-(3-anilinopropoxy)-1,3-dimethylpyrazol-4-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [5-(3-anilinopropoxy)-1,3-dimethylpyrazol-4-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 13277512 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [5-(3-anilinopropoxy)-1,3-dimethylpyrazol-4-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | Cc1nn(C)c(OCCCNc2ccccc2)c1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-14-19(20(27)17-10-9-15(22)13-18(17)23)21(26(2)25-14)28-12-6-11-24-16-7-4-3-5-8-16/h3-5,7-10,13,24H,6,11-12H2,1-2H3 |
| InChIKey | CIPCFISLKCUHIP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|