C23H23Cl2N3O2 — CID 13361381
(2,4-dichlorophenyl)-[1,3-dimethyl-5-[2-(N-prop-2-enylanilino)ethoxy]pyrazol-4-yl]methanone (PubChem CID 13361381) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[1,3-dimethyl-5-[2-(N-prop-2-enylanilino)ethoxy]pyrazol-4-yl]methanone.
| Compound Name | (2,4-dichlorophenyl)-[1,3-dimethyl-5-[2-(N-prop-2-enylanilino)ethoxy]pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 13361381 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2,4-dichlorophenyl)-[1,3-dimethyl-5-[2-(N-prop-2-enylanilino)ethoxy]pyrazol-4-yl]methanone |
| SMILES | C=CCN(CCOc1c(C(=O)c2ccc(Cl)cc2Cl)c(C)nn1C)c1ccccc1 |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-4-12-28(18-8-6-5-7-9-18)13-14-30-23-21(16(2)26-27(23)3)22(29)19-11-10-17(24)15-20(19)25/h4-11,15H,1,12-14H2,2-3H3 |
| InChIKey | IZRCWMLPDRCNCI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|