C18H19Cl2N3O5 — CID 12880057
4-chloro-1-[4-(4-chloro-2-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl]oxy-3,3-dimethylbutan-2-one (PubChem CID 12880057) has the molecular formula C18H19Cl2N3O5 and a molecular weight of 428.27 g/mol. Its IUPAC name is 4-chloro-1-[4-(4-chloro-2-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl]oxy-3,3-dimethylbutan-2-one.
| Compound Name | 4-chloro-1-[4-(4-chloro-2-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl]oxy-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 12880057 |
| Molecular Formula | C18H19Cl2N3O5 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-chloro-1-[4-(4-chloro-2-nitrobenzoyl)-1,3-dimethylpyrazol-5-yl]oxy-3,3-dimethylbutan-2-one |
| SMILES | Cc1nn(C)c(OCC(=O)C(C)(C)CCl)c1C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19Cl2N3O5/c1-10-15(16(25)12-6-5-11(20)7-13(12)23(26)27)17(22(4)21-10)28-8-14(24)18(2,3)9-19/h5-7H,8-9H2,1-4H3 |
| InChIKey | FKYISBUPMPNUAG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|