C11H7ClN2O4 — CID 54005429
(4-chloro-2-nitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 54005429) has the molecular formula C11H7ClN2O4 and a molecular weight of 266.64 g/mol. Its IUPAC name is (4-chloro-2-nitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone.
| Compound Name | (4-chloro-2-nitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 54005429 |
| Molecular Formula | C11H7ClN2O4 |
| Molecular Weight | 266.64 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | (4-chloro-2-nitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1oncc1C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7ClN2O4/c1-6-9(5-13-18-6)11(15)8-3-2-7(12)4-10(8)14(16)17/h2-5H,1H3 |
| InChIKey | KONQSMYFHFGPNB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|