C11H7N3O6 — CID 54227648
(2,4-dinitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 54227648) has the molecular formula C11H7N3O6 and a molecular weight of 277.19 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone.
| Compound Name | (2,4-dinitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 54227648 |
| Molecular Formula | C11H7N3O6 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (2,4-dinitrophenyl)-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1oncc1C(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7N3O6/c1-6-9(5-12-20-6)11(15)8-3-2-7(13(16)17)4-10(8)14(18)19/h2-5H,1H3 |
| InChIKey | QGZNITWOYITWOY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 129.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|