C18H11F3N2O4 — CID 54092555
[5-(4-methylphenyl)-1,2-oxazol-4-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone (PubChem CID 54092555) has the molecular formula C18H11F3N2O4 and a molecular weight of 376.29 g/mol. Its IUPAC name is [5-(4-methylphenyl)-1,2-oxazol-4-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-(4-methylphenyl)-1,2-oxazol-4-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 54092555 |
| Molecular Formula | C18H11F3N2O4 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [5-(4-methylphenyl)-1,2-oxazol-4-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone |
| SMILES | Cc1ccc(-c2oncc2C(=O)c2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H11F3N2O4/c1-10-2-4-11(5-3-10)17-14(9-22-27-17)16(24)13-7-6-12(18(19,20)21)8-15(13)23(25)26/h2-9H,1H3 |
| InChIKey | MUWDWKBJKVXNAT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|