C13H10ClN3O6 — CID 142739840
5-(4-chloro-2-nitrobenzoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 142739840) has the molecular formula C13H10ClN3O6 and a molecular weight of 339.69 g/mol. Its IUPAC name is 5-(4-chloro-2-nitrobenzoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-(4-chloro-2-nitrobenzoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142739840 |
| Molecular Formula | C13H10ClN3O6 |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 5-(4-chloro-2-nitrobenzoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(O)c(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H10ClN3O6/c1-15-11(19)9(12(20)16(2)13(15)21)10(18)7-4-3-6(14)5-8(7)17(22)23/h3-5,19H,1-2H3 |
| InChIKey | KGKHRBDCPXSQKH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|