C19H15ClN4O2 — CID 10713973
6-(4-chlorophenyl)-3-methyl-1-(4-nitrophenyl)-4,5-dihydropyrazolo[5,4-b]pyridine (PubChem CID 10713973) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-methyl-1-(4-nitrophenyl)-4,5-dihydropyrazolo[5,4-b]pyridine.
| Compound Name | 6-(4-chlorophenyl)-3-methyl-1-(4-nitrophenyl)-4,5-dihydropyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 10713973 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 6-(4-chlorophenyl)-3-methyl-1-(4-nitrophenyl)-4,5-dihydropyrazolo[5,4-b]pyridine |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c2c1CCC(c1ccc(Cl)cc1)=N2 |
| InChI | InChI=1S/C19H15ClN4O2/c1-12-17-10-11-18(13-2-4-14(20)5-3-13)21-19(17)23(22-12)15-6-8-16(9-7-15)24(25)26/h2-9H,10-11H2,1H3 |
| InChIKey | BEYQVMYCHGZORK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 73.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|