C13H9ClN4O2 — CID 174298070
6-chloro-3-methyl-1-(4-nitrophenyl)pyrazolo[4,3-c]pyridine (PubChem CID 174298070) has the molecular formula C13H9ClN4O2 and a molecular weight of 288.69 g/mol. Its IUPAC name is 6-chloro-3-methyl-1-(4-nitrophenyl)pyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-3-methyl-1-(4-nitrophenyl)pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 174298070 |
| Molecular Formula | C13H9ClN4O2 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 6-chloro-3-methyl-1-(4-nitrophenyl)pyrazolo[4,3-c]pyridine |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C13H9ClN4O2/c1-8-11-7-15-13(14)6-12(11)17(16-8)9-2-4-10(5-3-9)18(19)20/h2-7H,1H3 |
| InChIKey | CBVMBRFEYZXCOM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|