C20H13ClN4O4 — CID 1211946
(5-chloro-2-hydroxyphenyl)-[3-methyl-1-(4-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]methanone (PubChem CID 1211946) has the molecular formula C20H13ClN4O4 and a molecular weight of 408.80 g/mol. Its IUPAC name is (5-chloro-2-hydroxyphenyl)-[3-methyl-1-(4-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]methanone.
| Compound Name | (5-chloro-2-hydroxyphenyl)-[3-methyl-1-(4-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 1211946 |
| Molecular Formula | C20H13ClN4O4 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (5-chloro-2-hydroxyphenyl)-[3-methyl-1-(4-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]methanone |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c2ncc(C(=O)c3cc(Cl)ccc3O)cc12 |
| InChI | InChI=1S/C20H13ClN4O4/c1-11-16-8-12(19(27)17-9-13(21)2-7-18(17)26)10-22-20(16)24(23-11)14-3-5-15(6-4-14)25(28)29/h2-10,26H,1H3 |
| InChIKey | WAOQHIBGEMWHAS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|