C19H14ClN5O3 — CID 16846313
1-(3-chlorophenyl)-4-methyl-6-[(4-nitrophenyl)methyl]pyrazolo[4,5-d]pyridazin-7-one (PubChem CID 16846313) has the molecular formula C19H14ClN5O3 and a molecular weight of 395.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-methyl-6-[(4-nitrophenyl)methyl]pyrazolo[4,5-d]pyridazin-7-one.
| Compound Name | 1-(3-chlorophenyl)-4-methyl-6-[(4-nitrophenyl)methyl]pyrazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 16846313 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(3-chlorophenyl)-4-methyl-6-[(4-nitrophenyl)methyl]pyrazolo[4,5-d]pyridazin-7-one |
| SMILES | Cc1nn(Cc2ccc([N+](=O)[O-])cc2)c(=O)c2c1cnn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H14ClN5O3/c1-12-17-10-21-24(16-4-2-3-14(20)9-16)18(17)19(26)23(22-12)11-13-5-7-15(8-6-13)25(27)28/h2-10H,11H2,1H3 |
| InChIKey | UOIZLCOWTIJNNS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|