C19H16N4O — CID 16846168
6-benzyl-4-methyl-1-phenylpyrazolo[4,5-d]pyridazin-7-one (PubChem CID 16846168) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-benzyl-4-methyl-1-phenylpyrazolo[4,5-d]pyridazin-7-one.
| Compound Name | 6-benzyl-4-methyl-1-phenylpyrazolo[4,5-d]pyridazin-7-one |
|---|---|
| PubChem CID | 16846168 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6-benzyl-4-methyl-1-phenylpyrazolo[4,5-d]pyridazin-7-one |
| SMILES | Cc1nn(Cc2ccccc2)c(=O)c2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C19H16N4O/c1-14-17-12-20-23(16-10-6-3-7-11-16)18(17)19(24)22(21-14)13-15-8-4-2-5-9-15/h2-12H,13H2,1H3 |
| InChIKey | DPKXSSHWNOSCIL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |