About 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one
6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one (PubChem CID 16846719) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one.
Molecular Properties
| Compound Name | 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one |
| PubChem CID | 16846719 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one |
| SMILES | Cc1ccc(-n2ncc3c(C)nn(Cc4ccccc4)c(=O)c32)c(C)c1 |
| InChI | InChI=1S/C21H20N4O/c1-14-9-10-19(15(2)11-14)25-20-18(12-22-25)16(3)23-24(21(20)26)13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3 |
| InChIKey | JUYSSLANRIXFEH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one?
The IUPAC name of 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one (CID 16846719) is 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one.
What is the SMILES notation for 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one?
The canonical SMILES for 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one is Cc1ccc(-n2ncc3c(C)nn(Cc4ccccc4)c(=O)c32)c(C)c1.
What is the InChIKey of 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one?
The InChIKey is JUYSSLANRIXFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O/c1-14-9-10-19(15(2)11-14)25-20-18(12-22-25)16(3)23-24(21(20)26)13-17-7-5-4-6-8-17/h4-12H,13H2,1-3H3.
What are the key properties of 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one?
6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one has a molecular weight of 344.42 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-1-(2,4-dimethylphenyl)-4-methylpyrazolo[4,5-d]pyridazin-7-one is sourced from PubChem (CID 16846719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).