C19H19N3O2 — CID 891821
1-(4-ethylphenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole (PubChem CID 891821) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole.
| Compound Name | 1-(4-ethylphenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole |
|---|---|
| PubChem CID | 891821 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(4-ethylphenyl)-3,5-dimethyl-4-(3-nitrophenyl)pyrazole |
| SMILES | CCc1ccc(-n2nc(C)c(-c3cccc([N+](=O)[O-])c3)c2C)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-4-15-8-10-17(11-9-15)21-14(3)19(13(2)20-21)16-6-5-7-18(12-16)22(23)24/h5-12H,4H2,1-3H3 |
| InChIKey | GBIZVXFRSMTSSY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|