C18H14ClN3O4 — CID 3748516
1-(4-chlorophenyl)-5-ethyl-3-(3-nitrophenyl)pyrazole-4-carboxylic acid (PubChem CID 3748516) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-ethyl-3-(3-nitrophenyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-5-ethyl-3-(3-nitrophenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3748516 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-ethyl-3-(3-nitrophenyl)pyrazole-4-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(-c2cccc([N+](=O)[O-])c2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN3O4/c1-2-15-16(18(23)24)17(11-4-3-5-14(10-11)22(25)26)20-21(15)13-8-6-12(19)7-9-13/h3-10H,2H2,1H3,(H,23,24) |
| InChIKey | XMXPVEVJXFITJN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|