C19H16ClN3O4 — CID 70457649
2-(4-chlorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-4H-pyrimidine-5-carboxylic acid (PubChem CID 70457649) has the molecular formula C19H16ClN3O4 and a molecular weight of 385.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-4H-pyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-4H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 70457649 |
| Molecular Formula | C19H16ClN3O4 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-(4-chlorophenyl)-3,4-dimethyl-6-(3-nitrophenyl)-4H-pyrimidine-5-carboxylic acid |
| SMILES | CC1C(C(=O)O)=C(c2cccc([N+](=O)[O-])c2)N=C(c2ccc(Cl)cc2)N1C |
| InChI | InChI=1S/C19H16ClN3O4/c1-11-16(19(24)25)17(13-4-3-5-15(10-13)23(26)27)21-18(22(11)2)12-6-8-14(20)9-7-12/h3-11H,1-2H3,(H,24,25) |
| InChIKey | DDILDQAAOYJTSD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|