C19H23N3O5 — CID 57114289
propan-2-yl 2-methoxy-4-methyl-6-(3-nitrophenyl)-3-prop-2-enyl-4H-pyrimidine-5-carboxylate (PubChem CID 57114289) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is propan-2-yl 2-methoxy-4-methyl-6-(3-nitrophenyl)-3-prop-2-enyl-4H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 2-methoxy-4-methyl-6-(3-nitrophenyl)-3-prop-2-enyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 57114289 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | propan-2-yl 2-methoxy-4-methyl-6-(3-nitrophenyl)-3-prop-2-enyl-4H-pyrimidine-5-carboxylate |
| SMILES | C=CCN1C(OC)=NC(c2cccc([N+](=O)[O-])c2)=C(C(=O)OC(C)C)C1C |
| InChI | InChI=1S/C19H23N3O5/c1-6-10-21-13(4)16(18(23)27-12(2)3)17(20-19(21)26-5)14-8-7-9-15(11-14)22(24)25/h6-9,11-13H,1,10H2,2-5H3 |
| InChIKey | FUTPPPVLEHJZBA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|