C22H33N3O5 — CID 142994088
ethane;propan-2-yl 3-butyl-2-methoxy-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-5-carboxylate (PubChem CID 142994088) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is ethane;propan-2-yl 3-butyl-2-methoxy-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-5-carboxylate.
| Compound Name | ethane;propan-2-yl 3-butyl-2-methoxy-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142994088 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | ethane;propan-2-yl 3-butyl-2-methoxy-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-5-carboxylate |
| SMILES | CC.CCCCN1C(OC)=NC(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H27N3O5.C2H6/c1-6-7-11-22-18(15-9-8-10-16(12-15)23(25)26)17(19(24)28-13(2)3)14(4)21-20(22)27-5;1-2/h8-10,12-13,18H,6-7,11H2,1-5H3;1-2H3 |
| InChIKey | WPCZRUDXMBYLMF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|