C28H30N4O6S — CID 11364867
propan-2-yl 3-[3-[1-benzothiophene-2-carbonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 11364867) has the molecular formula C28H30N4O6S and a molecular weight of 550.64 g/mol. Its IUPAC name is propan-2-yl 3-[3-[1-benzothiophene-2-carbonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[1-benzothiophene-2-carbonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11364867 |
| Molecular Formula | C28H30N4O6S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | propan-2-yl 3-[3-[1-benzothiophene-2-carbonyl(methyl)amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)N(CCCN(C)C(=O)c2cc3ccccc3s2)C(=O)N1 |
| InChI | InChI=1S/C28H30N4O6S/c1-17(2)38-27(34)24-18(3)29-28(35)31(25(24)20-10-7-11-21(15-20)32(36)37)14-8-13-30(4)26(33)23-16-19-9-5-6-12-22(19)39-23/h5-7,9-12,15-17,25H,8,13-14H2,1-4H3,(H,29,35) |
| InChIKey | IAVJIYXPTJGIKX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|