C28H34N4O7 — CID 11364681
propan-2-yl 6-methyl-3-[3-[methyl-(2-phenylmethoxyacetyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 11364681) has the molecular formula C28H34N4O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is propan-2-yl 6-methyl-3-[3-[methyl-(2-phenylmethoxyacetyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 6-methyl-3-[3-[methyl-(2-phenylmethoxyacetyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11364681 |
| Molecular Formula | C28H34N4O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | propan-2-yl 6-methyl-3-[3-[methyl-(2-phenylmethoxyacetyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)N(CCCN(C)C(=O)COCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C28H34N4O7/c1-19(2)39-27(34)25-20(3)29-28(35)31(26(25)22-12-8-13-23(16-22)32(36)37)15-9-14-30(4)24(33)18-38-17-21-10-6-5-7-11-21/h5-8,10-13,16,19,26H,9,14-15,17-18H2,1-4H3,(H,29,35) |
| InChIKey | DUVSFSOUTZIYFY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|