C25H24N6O6 — CID 21077642
6-methyl-3-[3-[methyl(quinoxaline-2-carbonyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 21077642) has the molecular formula C25H24N6O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is 6-methyl-3-[3-[methyl(quinoxaline-2-carbonyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-[3-[methyl(quinoxaline-2-carbonyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 21077642 |
| Molecular Formula | C25H24N6O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 6-methyl-3-[3-[methyl(quinoxaline-2-carbonyl)amino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)N(CCCN(C)C(=O)c2cnc3ccccc3n2)C(=O)N1 |
| InChI | InChI=1S/C25H24N6O6/c1-15-21(24(33)34)22(16-7-5-8-17(13-16)31(36)37)30(25(35)27-15)12-6-11-29(2)23(32)20-14-26-18-9-3-4-10-19(18)28-20/h3-5,7-10,13-14,22H,6,11-12H2,1-2H3,(H,27,35)(H,33,34) |
| InChIKey | IDGPLTBMJRIHPY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 158.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|