C23H26N4O7S — CID 21077639
6-methyl-3-[3-[methyl-(2-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 21077639) has the molecular formula C23H26N4O7S and a molecular weight of 502.55 g/mol. Its IUPAC name is 6-methyl-3-[3-[methyl-(2-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-3-[3-[methyl-(2-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 21077639 |
| Molecular Formula | C23H26N4O7S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 6-methyl-3-[3-[methyl-(2-methylphenyl)sulfonylamino]propyl]-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)N(CCCN(C)S(=O)(=O)c2ccccc2C)C(=O)N1 |
| InChI | InChI=1S/C23H26N4O7S/c1-15-8-4-5-11-19(15)35(33,34)25(3)12-7-13-26-21(17-9-6-10-18(14-17)27(31)32)20(22(28)29)16(2)24-23(26)30/h4-6,8-11,14,21H,7,12-13H2,1-3H3,(H,24,30)(H,28,29) |
| InChIKey | POSHTNKAYCGKNY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|