C23H23ClN4O6 — CID 21077704
3-[3-[[2-(3-chlorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 21077704) has the molecular formula C23H23ClN4O6 and a molecular weight of 486.91 g/mol. Its IUPAC name is 3-[3-[[2-(3-chlorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 3-[3-[[2-(3-chlorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 21077704 |
| Molecular Formula | C23H23ClN4O6 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 3-[3-[[2-(3-chlorophenyl)-2-oxoethyl]amino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)N(CCCNCC(=O)c2cccc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C23H23ClN4O6/c1-14-20(22(30)31)21(16-6-3-8-18(12-16)28(33)34)27(23(32)26-14)10-4-9-25-13-19(29)15-5-2-7-17(24)11-15/h2-3,5-8,11-12,21,25H,4,9-10,13H2,1H3,(H,26,32)(H,30,31) |
| InChIKey | ABTDBLPCDMUUIW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|