C26H29ClN4O6 — CID 11318519
propan-2-yl 3-[3-[(4-chlorobenzoyl)-methylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 11318519) has the molecular formula C26H29ClN4O6 and a molecular weight of 528.99 g/mol. Its IUPAC name is propan-2-yl 3-[3-[(4-chlorobenzoyl)-methylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-[3-[(4-chlorobenzoyl)-methylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11318519 |
| Molecular Formula | C26H29ClN4O6 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | propan-2-yl 3-[3-[(4-chlorobenzoyl)-methylamino]propyl]-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)N(CCCN(C)C(=O)c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C26H29ClN4O6/c1-16(2)37-25(33)22-17(3)28-26(34)30(23(22)19-7-5-8-21(15-19)31(35)36)14-6-13-29(4)24(32)18-9-11-20(27)12-10-18/h5,7-12,15-16,23H,6,13-14H2,1-4H3,(H,28,34) |
| InChIKey | MSGOFCUUSCUPIM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|