C33H37N5O9 — CID 13240304
3-O-[6-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxy]hexyl] 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 13240304) has the molecular formula C33H37N5O9 and a molecular weight of 647.69 g/mol. Its IUPAC name is 3-O-[6-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxy]hexyl] 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[6-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxy]hexyl] 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13240304 |
| Molecular Formula | C33H37N5O9 |
| Molecular Weight | 647.69 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | 3-O-[6-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxy]hexyl] 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCCCCOc2cc(-c3cccc([N+](=O)[O-])c3)[nH]n2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C33H37N5O9/c1-20(2)47-33(40)30-22(4)34-21(3)29(31(30)24-12-10-14-26(18-24)38(43)44)32(39)46-16-8-6-5-7-15-45-28-19-27(35-36-28)23-11-9-13-25(17-23)37(41)42/h9-14,17-20,31,34H,5-8,15-16H2,1-4H3,(H,35,36) |
| InChIKey | OCFCGGFPVLBCPL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 188.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|