C31H42N4O7 — CID 70536325
3-O-ethyl 5-O-[7-[(5-propan-2-yl-1H-pyrazol-3-yl)oxy]octan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70536325) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is 3-O-ethyl 5-O-[7-[(5-propan-2-yl-1H-pyrazol-3-yl)oxy]octan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-[7-[(5-propan-2-yl-1H-pyrazol-3-yl)oxy]octan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70536325 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 3-O-ethyl 5-O-[7-[(5-propan-2-yl-1H-pyrazol-3-yl)oxy]octan-2-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)CCCCC(C)Oc2cc(C(C)C)[nH]n2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H42N4O7/c1-8-40-30(36)27-21(6)32-22(7)28(29(27)23-14-11-15-24(16-23)35(38)39)31(37)42-20(5)13-10-9-12-19(4)41-26-17-25(18(2)3)33-34-26/h11,14-20,29,32H,8-10,12-13H2,1-7H3,(H,33,34) |
| InChIKey | PCJNLWNQRPDTRP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|