C33H37ClN4O7 — CID 13240345
5-O-[7-[[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]heptan-2-yl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 13240345) has the molecular formula C33H37ClN4O7 and a molecular weight of 637.13 g/mol. Its IUPAC name is 5-O-[7-[[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]heptan-2-yl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[7-[[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]heptan-2-yl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13240345 |
| Molecular Formula | C33H37ClN4O7 |
| Molecular Weight | 637.13 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 5-O-[7-[[5-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]heptan-2-yl] 3-O-ethyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)CCCCCOc2cc(-c3ccc(Cl)cc3)[nH]n2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H37ClN4O7/c1-5-43-32(39)29-21(3)35-22(4)30(31(29)24-11-9-12-26(18-24)38(41)42)33(40)45-20(2)10-7-6-8-17-44-28-19-27(36-37-28)23-13-15-25(34)16-14-23/h9,11-16,18-20,31,35H,5-8,10,17H2,1-4H3,(H,36,37) |
| InChIKey | KIGNHAPZPNMFDP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.13 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|