C22H25N3O8 — CID 110273630
propan-2-yl 3-(3-methoxy-3-oxopropanoyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-1-prop-2-enyl-4H-pyrimidine-5-carboxylate (PubChem CID 110273630) has the molecular formula C22H25N3O8 and a molecular weight of 459.46 g/mol. Its IUPAC name is propan-2-yl 3-(3-methoxy-3-oxopropanoyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-1-prop-2-enyl-4H-pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 3-(3-methoxy-3-oxopropanoyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-1-prop-2-enyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110273630 |
| Molecular Formula | C22H25N3O8 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | propan-2-yl 3-(3-methoxy-3-oxopropanoyl)-6-methyl-4-(3-nitrophenyl)-2-oxo-1-prop-2-enyl-4H-pyrimidine-5-carboxylate |
| SMILES | C=CCN1C(=O)N(C(=O)CC(=O)OC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C1C |
| InChI | InChI=1S/C22H25N3O8/c1-6-10-23-14(4)19(21(28)33-13(2)3)20(15-8-7-9-16(11-15)25(30)31)24(22(23)29)17(26)12-18(27)32-5/h6-9,11,13,20H,1,10,12H2,2-5H3 |
| InChIKey | PWSWQUZJFBBOAW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|