C16H16N4O4S — CID 10316466
4-[3-methoxy-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide (PubChem CID 10316466) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-[3-methoxy-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-methoxy-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10316466 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[3-methoxy-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(-c2nc(OC)nn2-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-23-13-7-3-11(4-8-13)15-18-16(24-2)19-20(15)12-5-9-14(10-6-12)25(17,21)22/h3-10H,1-2H3,(H2,17,21,22) |
| InChIKey | LLZQGDQZFDIKSU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |