C14H11BrN4O3S — CID 135434992
4-[(6-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide (PubChem CID 135434992) has the molecular formula C14H11BrN4O3S and a molecular weight of 395.24 g/mol. Its IUPAC name is 4-[(6-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide.
| Compound Name | 4-[(6-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135434992 |
| Molecular Formula | C14H11BrN4O3S |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 4-[(6-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3cc(Br)ccc23)cc1 |
| InChI | InChI=1S/C14H11BrN4O3S/c15-8-1-6-11-12(7-8)17-14(20)13(11)19-18-9-2-4-10(5-3-9)23(16,21)22/h1-7,17,20H,(H2,16,21,22)/b19-18+ |
| InChIKey | FITNLFQULPJFRL-VHEBQXMUSA-N |
| XLogP | 3.70 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|