C26H22Cl2N6O10S3 — CID 71367133
2,5-dichloro-4-[4-[[4-[[4-(ethenylsulfonylmethylamino)benzoyl]amino]-2-sulfophenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid (PubChem CID 71367133) has the molecular formula C26H22Cl2N6O10S3 and a molecular weight of 745.60 g/mol. Its IUPAC name is 2,5-dichloro-4-[4-[[4-[[4-(ethenylsulfonylmethylamino)benzoyl]amino]-2-sulfophenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[4-[[4-[[4-(ethenylsulfonylmethylamino)benzoyl]amino]-2-sulfophenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71367133 |
| Molecular Formula | C26H22Cl2N6O10S3 |
| Molecular Weight | 745.60 g/mol |
| Exact Mass | 743.99 |
| IUPAC Name | 2,5-dichloro-4-[4-[[4-[[4-(ethenylsulfonylmethylamino)benzoyl]amino]-2-sulfophenyl]diazenyl]-3-methyl-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CNc1ccc(C(=O)Nc2ccc(/N=N/C3C(=O)N(c4cc(Cl)c(S(=O)(=O)O)cc4Cl)N=C3C)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C26H22Cl2N6O10S3/c1-3-45(37,38)13-29-16-6-4-15(5-7-16)25(35)30-17-8-9-20(23(10-17)47(42,43)44)31-32-24-14(2)33-34(26(24)36)21-11-19(28)22(12-18(21)27)46(39,40)41/h3-12,24,29H,1,13H2,2H3,(H,30,35)(H,39,40,41)(H,42,43,44)/b32-31+ |
| InChIKey | CEEWIDSRCUABTM-QNEJGDQOSA-N |
| XLogP | 4.54 |
| TPSA | 241.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|