C21H15Cl2N7Na2O7S — CID 170854004
CID 170854004 (PubChem CID 170854004) has the molecular formula C21H15Cl2N7Na2O7S and a molecular weight of 626.35 g/mol.
| Compound Name | CID 170854004 |
|---|---|
| PubChem CID | 170854004 |
| Molecular Formula | C21H15Cl2N7Na2O7S |
| Molecular Weight | 626.35 g/mol |
| Exact Mass | 624.99 |
| IUPAC Name | — |
| SMILES | CC1=NN(CC(=O)O)C(=O)C1/N=N/c1ccc(NC(=O)c2ccc3nc(Cl)c(Cl)nc3c2)cc1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C21H15Cl2N7O7S.2Na/c1-9-17(21(34)30(29-9)8-16(31)32)28-27-13-5-3-11(7-15(13)38(35,36)37)24-20(33)10-2-4-12-14(6-10)26-19(23)18(22)25-12;;/h2-7,17H,8H2,1H3,(H,24,33)(H,31,32)(H,35,36,37);;/b28-27+;; |
| InChIKey | PXVJPHKMJYGCGX-JZYARHMISA-N |
| XLogP | 2.43 |
| TPSA | 203.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|