C19H14BrCl2N5Na2O8S2 — CID 131883725
CID 131883725 (PubChem CID 131883725) has the molecular formula C19H14BrCl2N5Na2O8S2 and a molecular weight of 701.27 g/mol.
| Compound Name | CID 131883725 |
|---|---|
| PubChem CID | 131883725 |
| Molecular Formula | C19H14BrCl2N5Na2O8S2 |
| Molecular Weight | 701.27 g/mol |
| Exact Mass | 698.86 |
| IUPAC Name | — |
| SMILES | C=C(Br)C(=O)Nc1ccc(S(=O)(=O)O)c(/N=N/C2C(=O)N(c3cc(Cl)c(S(=O)(=O)O)cc3Cl)N=C2C)c1.[Na].[Na] |
| InChI | InChI=1S/C19H14BrCl2N5O8S2.2Na/c1-8(20)18(28)23-10-3-4-15(36(30,31)32)13(5-10)24-25-17-9(2)26-27(19(17)29)14-6-12(22)16(7-11(14)21)37(33,34)35;;/h3-7,17H,1H2,2H3,(H,23,28)(H,30,31,32)(H,33,34,35);;/b25-24+;; |
| InChIKey | JRVPZMWUSBEOGQ-JQCJJEDZSA-N |
| XLogP | 3.45 |
| TPSA | 195.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|