C27H23Cl2N9NaO4S — CID 170851273
CID 170851273 (PubChem CID 170851273) has the molecular formula C27H23Cl2N9NaO4S and a molecular weight of 663.50 g/mol.
| Compound Name | CID 170851273 |
|---|---|
| PubChem CID | 170851273 |
| Molecular Formula | C27H23Cl2N9NaO4S |
| Molecular Weight | 663.50 g/mol |
| Exact Mass | 662.09 |
| IUPAC Name | — |
| SMILES | CCN(c1ccccc1)c1nc(Cl)nc(Nc2ccc(S(=O)(=O)O)c(/N=N/C3C(=O)N(c4ccccc4Cl)N=C3C)c2)n1.[Na] |
| InChI | InChI=1S/C27H23Cl2N9O4S.Na/c1-3-37(18-9-5-4-6-10-18)27-32-25(29)31-26(33-27)30-17-13-14-22(43(40,41)42)20(15-17)34-35-23-16(2)36-38(24(23)39)21-12-8-7-11-19(21)28;/h4-15,23H,3H2,1-2H3,(H,40,41,42)(H,30,31,32,33);/b35-34+; |
| InChIKey | MIYCBZQPXSKQMP-LOSWNTLOSA-N |
| XLogP | 5.82 |
| TPSA | 165.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|