C19H12Cl3N8NaO4S — CID 102057848
sodium 2-[[1-(2-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate (PubChem CID 102057848) has the molecular formula C19H12Cl3N8NaO4S and a molecular weight of 577.77 g/mol. Its IUPAC name is sodium 2-[[1-(2-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate.
| Compound Name | sodium 2-[[1-(2-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 102057848 |
| Molecular Formula | C19H12Cl3N8NaO4S |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 575.97 |
| IUPAC Name | sodium 2-[[1-(2-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
| SMILES | CC1=NN(c2ccccc2Cl)C(=O)C1/N=N/c1cc(Nc2nc(Cl)nc(Cl)n2)ccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H13Cl3N8O4S.Na/c1-9-15(16(31)30(29-9)13-5-3-2-4-11(13)20)28-27-12-8-10(6-7-14(12)35(32,33)34)23-19-25-17(21)24-18(22)26-19;/h2-8,15H,1H3,(H,32,33,34)(H,23,24,25,26);/q;+1/p-1/b28-27+; |
| InChIKey | MOYKKFMVRCUCDN-RXQWRGDBSA-M |
| XLogP | 1.36 |
| TPSA | 165.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|