C17H21ClN6O7S2 — CID 72941701
diazanium;4-chloro-5-methyl-2-[[3-methyl-5-oxo-1-(3-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzenesulfonate (PubChem CID 72941701) has the molecular formula C17H21ClN6O7S2 and a molecular weight of 520.98 g/mol. Its IUPAC name is diazanium;4-chloro-5-methyl-2-[[3-methyl-5-oxo-1-(3-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzenesulfonate.
| Compound Name | diazanium;4-chloro-5-methyl-2-[[3-methyl-5-oxo-1-(3-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 72941701 |
| Molecular Formula | C17H21ClN6O7S2 |
| Molecular Weight | 520.98 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | diazanium;4-chloro-5-methyl-2-[[3-methyl-5-oxo-1-(3-sulfonatophenyl)-4H-pyrazol-4-yl]diazenyl]benzenesulfonate |
| SMILES | CC1=NN(c2cccc(S(=O)(=O)[O-])c2)C(=O)C1/N=N/c1cc(Cl)c(C)cc1S(=O)(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C17H15ClN4O7S2.2H3N/c1-9-6-15(31(27,28)29)14(8-13(9)18)19-20-16-10(2)21-22(17(16)23)11-4-3-5-12(7-11)30(24,25)26;;/h3-8,16H,1-2H3,(H,24,25,26)(H,27,28,29);2*1H3/b20-19+;; |
| InChIKey | KOJNKGSMYHNILJ-LLIZZRELSA-N |
| XLogP | 3.08 |
| TPSA | 244.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.98 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|