C23H16Cl2N5NaO6S — CID 135570496
sodium 2-[[2-chloro-4-[[1-(3-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-5-hydroxyphenyl]sulfonylamino]benzoate (PubChem CID 135570496) has the molecular formula C23H16Cl2N5NaO6S and a molecular weight of 584.37 g/mol. Its IUPAC name is sodium 2-[[2-chloro-4-[[1-(3-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-5-hydroxyphenyl]sulfonylamino]benzoate.
| Compound Name | sodium 2-[[2-chloro-4-[[1-(3-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-5-hydroxyphenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 135570496 |
| Molecular Formula | C23H16Cl2N5NaO6S |
| Molecular Weight | 584.37 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | sodium 2-[[2-chloro-4-[[1-(3-chlorophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-5-hydroxyphenyl]sulfonylamino]benzoate |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)C1/N=N/c1cc(Cl)c(S(=O)(=O)Nc2ccccc2C(=O)[O-])cc1O.[Na+] |
| InChI | InChI=1S/C23H17Cl2N5O6S.Na/c1-12-21(22(32)30(28-12)14-6-4-5-13(24)9-14)27-26-18-10-16(25)20(11-19(18)31)37(35,36)29-17-8-3-2-7-15(17)23(33)34;/h2-11,21,29,31H,1H3,(H,33,34);/q;+1/p-1/b27-26+; |
| InChIKey | ZSNAWJQXWUXEBG-JGUILPGDSA-M |
| XLogP | 0.74 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|