C29H17Cl2N5O12S3 — CID 131855159
5-amino-8-[3-[(2,3-dichloroquinoxaline-6-carbonyl)amino]anilino]-9,10-dioxoanthracene-1,4,6-trisulfonic acid (PubChem CID 131855159) has the molecular formula C29H17Cl2N5O12S3 and a molecular weight of 794.59 g/mol. Its IUPAC name is 5-amino-8-[3-[(2,3-dichloroquinoxaline-6-carbonyl)amino]anilino]-9,10-dioxoanthracene-1,4,6-trisulfonic acid.
| Compound Name | 5-amino-8-[3-[(2,3-dichloroquinoxaline-6-carbonyl)amino]anilino]-9,10-dioxoanthracene-1,4,6-trisulfonic acid |
|---|---|
| PubChem CID | 131855159 |
| Molecular Formula | C29H17Cl2N5O12S3 |
| Molecular Weight | 794.59 g/mol |
| Exact Mass | 792.94 |
| IUPAC Name | 5-amino-8-[3-[(2,3-dichloroquinoxaline-6-carbonyl)amino]anilino]-9,10-dioxoanthracene-1,4,6-trisulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2cccc(NC(=O)c3ccc4nc(Cl)c(Cl)nc4c3)c2)c2c1C(=O)c1c(S(=O)(=O)O)ccc(S(=O)(=O)O)c1C2=O |
| InChI | InChI=1S/C29H17Cl2N5O12S3/c30-27-28(31)36-15-8-11(4-5-14(15)35-27)29(39)34-13-3-1-2-12(9-13)33-16-10-19(51(46,47)48)24(32)23-20(16)25(37)21-17(49(40,41)42)6-7-18(50(43,44)45)22(21)26(23)38/h1-10,33H,32H2,(H,34,39)(H,40,41,42)(H,43,44,45)(H,46,47,48) |
| InChIKey | IJRSMQUNDOUGLT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 290.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|