C34H29N11NaO6 — CID 170840686
CID 170840686 (PubChem CID 170840686) has the molecular formula C34H29N11NaO6 and a molecular weight of 710.67 g/mol.
| Compound Name | CID 170840686 |
|---|---|
| PubChem CID | 170840686 |
| Molecular Formula | C34H29N11NaO6 |
| Molecular Weight | 710.67 g/mol |
| Exact Mass | 710.22 |
| IUPAC Name | — |
| SMILES | CC1=NN(c2ccc(N)cc2)C(=O)C1/N=N/c1cc(C(=O)Nc2ccc(/N=N/C3C(=O)N(c4ccc(N)cc4)N=C3C)c(C(=O)O)c2)ccc1O.[Na] |
| InChI | InChI=1S/C34H29N11O6.Na/c1-17-29(32(48)44(42-17)23-9-4-20(35)5-10-23)40-38-26-13-8-22(16-25(26)34(50)51)37-31(47)19-3-14-28(46)27(15-19)39-41-30-18(2)43-45(33(30)49)24-11-6-21(36)7-12-24;/h3-16,29-30,46H,35-36H2,1-2H3,(H,37,47)(H,50,51);/b40-38+,41-39+; |
| InChIKey | NNLXTCPZVWKZJB-VXEFGMLISA-N |
| XLogP | 4.88 |
| TPSA | 253.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.67 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|