C25H21N5O5 — CID 135469604
3-[2-hydroxy-3-[[3-methyl-1-[4-(methylcarbamoyl)phenyl]-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid (PubChem CID 135469604) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[[3-methyl-1-[4-(methylcarbamoyl)phenyl]-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid.
| Compound Name | 3-[2-hydroxy-3-[[3-methyl-1-[4-(methylcarbamoyl)phenyl]-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135469604 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[2-hydroxy-3-[[3-methyl-1-[4-(methylcarbamoyl)phenyl]-5-oxo-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
| SMILES | CNC(=O)c1ccc(N2N=C(C)C(/N=N/c3cccc(-c4cccc(C(=O)O)c4)c3O)C2=O)cc1 |
| InChI | InChI=1S/C25H21N5O5/c1-14-21(24(33)30(29-14)18-11-9-15(10-12-18)23(32)26-2)28-27-20-8-4-7-19(22(20)31)16-5-3-6-17(13-16)25(34)35/h3-13,21,31H,1-2H3,(H,26,32)(H,34,35)/b28-27+ |
| InChIKey | XJCTVYYTSCSKBY-BYYHNAKLSA-N |
| XLogP | 3.99 |
| TPSA | 144.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|