C25H19F3N4O4S — CID 135779901
3-[2-hydroxy-3-[[3-(methylsulfanylmethyl)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid (PubChem CID 135779901) has the molecular formula C25H19F3N4O4S and a molecular weight of 528.51 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[[3-(methylsulfanylmethyl)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid.
| Compound Name | 3-[2-hydroxy-3-[[3-(methylsulfanylmethyl)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135779901 |
| Molecular Formula | C25H19F3N4O4S |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 3-[2-hydroxy-3-[[3-(methylsulfanylmethyl)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
| SMILES | CSCC1=NN(c2ccc(C(F)(F)F)cc2)C(=O)C1/N=N/c1cccc(-c2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C25H19F3N4O4S/c1-37-13-20-21(23(34)32(31-20)17-10-8-16(9-11-17)25(26,27)28)30-29-19-7-3-6-18(22(19)33)14-4-2-5-15(12-14)24(35)36/h2-12,21,33H,13H2,1H3,(H,35,36)/b30-29+ |
| InChIKey | JDEFZXFISYHFFI-QVIHXGFCSA-N |
| XLogP | 5.99 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|