C28H20ClN3O4 — CID 135424907
3-[3-[(1-benzyl-5-chloro-2-hydroxyindol-3-yl)diazenyl]-2-hydroxyphenyl]benzoic acid (PubChem CID 135424907) has the molecular formula C28H20ClN3O4 and a molecular weight of 497.94 g/mol. Its IUPAC name is 3-[3-[(1-benzyl-5-chloro-2-hydroxyindol-3-yl)diazenyl]-2-hydroxyphenyl]benzoic acid.
| Compound Name | 3-[3-[(1-benzyl-5-chloro-2-hydroxyindol-3-yl)diazenyl]-2-hydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 135424907 |
| Molecular Formula | C28H20ClN3O4 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 3-[3-[(1-benzyl-5-chloro-2-hydroxyindol-3-yl)diazenyl]-2-hydroxyphenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(/N=N/c3c(O)n(Cc4ccccc4)c4ccc(Cl)cc34)c2O)c1 |
| InChI | InChI=1S/C28H20ClN3O4/c29-20-12-13-24-22(15-20)25(27(34)32(24)16-17-6-2-1-3-7-17)31-30-23-11-5-10-21(26(23)33)18-8-4-9-19(14-18)28(35)36/h1-15,33-34H,16H2,(H,35,36)/b31-30+ |
| InChIKey | OIYJPMSVNABKQM-NVQSTNCTSA-N |
| XLogP | 7.53 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|