C26H21ClN6O2S — CID 162673685
1-benzyl-5-chloro-3-[[5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-yl]diazenyl]indol-2-ol (PubChem CID 162673685) has the molecular formula C26H21ClN6O2S and a molecular weight of 517.01 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-[[5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-yl]diazenyl]indol-2-ol.
| Compound Name | 1-benzyl-5-chloro-3-[[5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-yl]diazenyl]indol-2-ol |
|---|---|
| PubChem CID | 162673685 |
| Molecular Formula | C26H21ClN6O2S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1-benzyl-5-chloro-3-[[5-[(4-methoxyphenyl)diazenyl]-4-methyl-1,3-thiazol-2-yl]diazenyl]indol-2-ol |
| SMILES | COc1ccc(/N=N/c2sc(/N=N/c3c(O)n(Cc4ccccc4)c4ccc(Cl)cc34)nc2C)cc1 |
| InChI | InChI=1S/C26H21ClN6O2S/c1-16-24(31-29-19-9-11-20(35-2)12-10-19)36-26(28-16)32-30-23-21-14-18(27)8-13-22(21)33(25(23)34)15-17-6-4-3-5-7-17/h3-14,34H,15H2,1-2H3/b31-29+,32-30+ |
| InChIKey | USJBUDXOGMINSZ-JWTBXLROSA-N |
| XLogP | 8.65 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|