C31H24F3N3O4 — CID 135508156
3-[2-hydroxy-3-[[2-hydroxy-1-(4-propylphenyl)-5-(trifluoromethyl)indol-3-yl]diazenyl]phenyl]benzoic acid (PubChem CID 135508156) has the molecular formula C31H24F3N3O4 and a molecular weight of 559.54 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[[2-hydroxy-1-(4-propylphenyl)-5-(trifluoromethyl)indol-3-yl]diazenyl]phenyl]benzoic acid.
| Compound Name | 3-[2-hydroxy-3-[[2-hydroxy-1-(4-propylphenyl)-5-(trifluoromethyl)indol-3-yl]diazenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135508156 |
| Molecular Formula | C31H24F3N3O4 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 3-[2-hydroxy-3-[[2-hydroxy-1-(4-propylphenyl)-5-(trifluoromethyl)indol-3-yl]diazenyl]phenyl]benzoic acid |
| SMILES | CCCc1ccc(-n2c(O)c(/N=N/c3cccc(-c4cccc(C(=O)O)c4)c3O)c3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C31H24F3N3O4/c1-2-5-18-10-13-22(14-11-18)37-26-15-12-21(31(32,33)34)17-24(26)27(29(37)39)36-35-25-9-4-8-23(28(25)38)19-6-3-7-20(16-19)30(40)41/h3-4,6-17,38-39H,2,5H2,1H3,(H,40,41)/b36-35+ |
| InChIKey | NFXJWOOHPYQUOR-ULDVOPSXSA-N |
| XLogP | 8.79 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|