C32H25F3N2O4 — CID 136595948
3-[3-[1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxyphenyl]benzoic acid (PubChem CID 136595948) has the molecular formula C32H25F3N2O4 and a molecular weight of 558.56 g/mol. Its IUPAC name is 3-[3-[1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxyphenyl]benzoic acid.
| Compound Name | 3-[3-[1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 136595948 |
| Molecular Formula | C32H25F3N2O4 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 3-[3-[1-[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]ethylideneamino]-2-hydroxyphenyl]benzoic acid |
| SMILES | C/C(=N\c1cccc(-c2cccc(C(=O)O)c2)c1O)c1c(O)n(-c2cc(C)cc(C)c2)c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C32H25F3N2O4/c1-17-12-18(2)14-23(13-17)37-27-16-22(32(33,34)35)10-11-25(27)28(30(37)39)19(3)36-26-9-5-8-24(29(26)38)20-6-4-7-21(15-20)31(40)41/h4-16,38-39H,1-3H3,(H,40,41)/b36-19+ |
| InChIKey | CICWNZFBRYEAAL-ODNPBWNPSA-N |
| XLogP | 8.18 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|